2,5-Diethoxy-α,4-diethylphenethylamine
1-(2,5-Diethoxy-4-ethylphenyl)butan-2-amine
 1211 C16H27NO2 265.391
 InChI=1S/C16H27NO2/c1-5-12-10-16(19-8-4)13(9-14(17)6-2)11-15(12)18-7-3/h10-11,14H,5-9,17H2,1-4H3
 CVJQARLFWMPJBL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1cc(CC)c(cc1CC(CC)N)OCC