Indole
1H-Indole
 12100 C8H7N 117.148
 InChI=1S/C8H7N/c1-2-4-8-7(3-1)5-6-9-8/h1-6,9H
 SIKJAQJRHWYJAI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 c1ccc2c(c1)[nH]cc2