5-Ethoxy-α-ethyl-2-methoxy-4-methylphenethylamine
1-(5-Ethoxy-2-methoxy-4-methylphenyl)butan-2-amine
 1209 C14H23NO2 237.338
 InChI=1S/C14H23NO2/c1-5-12(15)8-11-9-13(17-6-2)10(3)7-14(11)16-4/h7,9,12H,5-6,8,15H2,1-4H3
 UIHSTWGVHGNRGG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1cc(CC(CC)N)c(cc1C)OC