1,1′-Disulfanediylbis(N-methyl-1-phenylpropan-2-amine)
 12009 C20H28N2S2 360.58
 InChI=1S/C20H28N2S2/c1-15(21-3)19(17-11-7-5-8-12-17)23-24-20(16(2)22-4)18-13-9-6-10-14-18/h5-16,19-22H,1-4H3
 YVBDCJIORSABCM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(c1ccccc1)SSC(c1ccccc1)C(NC)C)C