β-Hydroxy psilocin
3-[2-(Dimethylamino)-1-hydroxyethyl]-1H-indol-4-ol
 11260  C12H16N2O2  220.268
 InChI=1S/C12H16N2O2/c1-14(2)7-11(16)8-6-13-9-4-3-5-10(15)12(8)9/h3-6,11,13,15-16H,7H2,1-2H3
 VPFZUVXKJXOEAA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CC(c1c[nH]c2c1c(O)ccc2)O)C