4-BnO-DET
2-[4-(Benzyloxy)-1H-indol-3-yl]-N,N-diethylethan-1-amine
 11070  C21H26N2O  322.444
 InChI=1S/C21H26N2O/c1-3-23(4-2)14-13-18-15-22-19-11-8-12-20(21(18)19)24-16-17-9-6-5-7-10-17/h5-12,15,22H,3-4,13-14,16H2,1-2H3
 FBICNCYJPHBDGN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(CCc1c[nH]c2c1c(ccc2)OCc1ccccc1)CC