N-[1-(4-Hydroxyphenyl)propan-2-yl]acetamide
 1094 C11H15NO2 193.242
 InChI=1S/C11H15NO2/c1-8(12-9(2)13)7-10-3-5-11(14)6-4-10/h3-6,8,14H,7H2,1-2H3,(H,12,13)
 ZBLINTGLDYSGCA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(cc1)O)NC(=O)C