3-Phenylpyrrolidine
 10900 C10H13N 147.217
 InChI=1S/C10H13N/c1-2-4-9(5-3-1)10-6-7-11-8-10/h1-5,10-11H,6-8H2
 PRRFFTYUBPGHLE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C1NCC(C1)c1ccccc1