4-Methyl-THIQ
4-Methyl-1,2,3,4-tetrahydroisoquinoline
 10879 C10H13N 147.217
 InChI=1S/C10H13N/c1-8-6-11-7-9-4-2-3-5-10(8)9/h2-5,8,11H,6-7H2,1H3
 TWIPIAJYKZMIPL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC1CNCc2c1cccc2