N-(3-Phenylpropyl)-2,3-dihydro-1H-inden-2-amine
 10874  C18H21N  251.366
 InChI=1S/C18H21N/c1-2-7-15(8-3-1)9-6-12-19-18-13-16-10-4-5-11-17(16)14-18/h1-5,7-8,10-11,18-19H,6,9,12-14H2
 HQOMLTLQWBDVRA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C(NC1Cc2c(C1)cccc2)CCc1ccccc1