HOT-2-AT
N-Hydroxy-1,2,3,4-tetrahydronaphthalen-2-amine
 1086 C10H13NO 163.216
 InChI=1S/C10H13NO/c12-11-10-6-5-8-3-1-2-4-9(8)7-10/h1-4,10-12H,5-7H2
 ZPELESCWLJSVCY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 ONC1CCc2c(C1)cccc2