1-(2-Phenylethyl)aziridine
 10842 C10H13N 147.217
 InChI=1S/C10H13N/c1-2-4-10(5-3-1)6-7-11-8-9-11/h1-5H,6-9H2
 QSHMWSLFNQLCNI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 c1ccc(cc1)CCN1CC1