2,2-Dimethyl-3-phenylaziridine
 10841 C10H13N 147.217
 InChI=1S/C10H13N/c1-10(2)9(11-10)8-6-4-3-5-7-8/h3-7,9,11H,1-2H3
 MJEWPHXVKWPHMF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC1(C)NC1c1ccccc1