2-Ethyl-3-phenylaziridine
 10840 C10H13N 147.217
 InChI=1S/C10H13N/c1-2-9-10(11-9)8-6-4-3-5-7-8/h3-7,9-11H,2H2,1H3
 JICMYGGVFKPYBW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC1NC1c1ccccc1