2-Benzylcyclopropan-1-amine
 10823 C10H13N 147.217
 InChI=1S/C10H13N/c11-10-7-9(10)6-8-4-2-1-3-5-8/h1-5,9-10H,6-7,11H2
 YDILPQKPMIOWTJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NC1CC1Cc1ccccc1