1-(2-Phenylcyclopropyl)methanamine
 10822 C10H13N 147.217
 InChI=1S/C10H13N/c11-7-9-6-10(9)8-4-2-1-3-5-8/h1-5,9-10H,6-7,11H2
 ATTLDOZXPZCOGK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC1CC1c1ccccc1