4-Methyl-3-phenylpentan-2-amine
 10795 C12H19N 177.286
 InChI=1S/C12H19N/c1-9(2)12(10(3)13)11-7-5-4-6-8-11/h4-10,12H,13H2,1-3H3
 NZOGHVVWPMOKMC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(C(c1ccccc1)C(N)C)C