3-Phenylhexan-2-amine
 10794 C12H19N 177.286
 InChI=1S/C12H19N/c1-3-7-12(10(2)13)11-8-5-4-6-9-11/h4-6,8-10,12H,3,7,13H2,1-2H3
 NYZKYFHVVOGWFE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCC(c1ccccc1)C(N)C