2-Phenylbut-3-yn-1-amine
 10790  C10H11N  145.201
 InChI=1S/C10H11N/c1-2-9(8-11)10-6-4-3-5-7-10/h1,3-7,9H,8,11H2
 UTPTXRJAFWMTMH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(c1ccccc1)C#C