2-Phenylbut-3-en-1-amine
 10789 C10H13N 147.217
 InChI=1S/C10H13N/c1-2-9(8-11)10-6-4-3-5-7-10/h2-7,9H,1,8,11H2
 FXIQEDXPHQLKSZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(c1ccccc1)C=C