N-Ethyl-2-phenylbutan-1-amine
 10785 C12H19N 177.286
 InChI=1S/C12H19N/c1-3-11(10-13-4-2)12-8-6-5-7-9-12/h5-9,11,13H,3-4,10H2,1-2H3
 CKDGQUSKFUAVSS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNCC(c1ccccc1)CC