N,N-Dimethyl-2-phenylbutan-1-amine
 10784 C12H19N 177.286
 InChI=1S/C12H19N/c1-4-11(10-13(2)3)12-8-6-5-7-9-12/h5-9,11H,4,10H2,1-3H3
 UMAKZNFESLTKKX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(c1ccccc1)CN(C)C