2-Phenylbutan-1-amine
 10782 C10H15N 149.233
 InChI=1S/C10H15N/c1-2-9(8-11)10-6-4-3-5-7-10/h3-7,9H,2,8,11H2,1H3
 PLWALTDUYKDGRF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(c1ccccc1)CN