Zylofuramine
N-Ethyl-1-(oxolan-2-yl)-2-phenylethan-1-amine
 10779 C14H21NO 219.323
 InChI=1S/C14H21NO/c1-2-15-13(14-9-6-10-16-14)11-12-7-4-3-5-8-12/h3-5,7-8,13-15H,2,6,9-11H2,1H3
 DOFCLOLKFGSRTG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC(C1CCCO1)Cc1ccccc1