N-Methyl-1-phenylpentan-2-amine
 10775 C12H19N 177.286
 InChI=1S/C12H19N/c1-3-7-12(13-2)10-11-8-5-4-6-9-11/h4-6,8-9,12-13H,3,7,10H2,1-2H3
 DLAJEPYNASSTER-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCC(Cc1ccccc1)NC