3-I-TMA-6
1-(3-Iodo-2,4,6-trimethoxyphenyl)propan-2-amine
 1077  C12H18INO3  351.181
 InChI=1S/C12H18INO3/c1-7(14)5-8-9(15-2)6-10(16-3)11(13)12(8)17-4/h6-7H,5,14H2,1-4H3
 PSDRKRQLERYHON-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(OC)c(c(c1CC(N)C)OC)I