1-Phenylhexan-2-amine
 10764 C12H19N 177.286
 InChI=1S/C12H19N/c1-2-3-9-12(13)10-11-7-5-4-6-8-11/h4-8,12H,2-3,9-10,13H2,1H3
 UNVLUPRQPLQYGW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCC(Cc1ccccc1)N