2-Bromo-N,N-dimethyl-2-phenylethan-1-amine
 10762  C10H14BrN  228.129
 InChI=1S/C10H14BrN/c1-12(2)8-10(11)9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3
 FAYDKYWSKJYIRG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 BrC(c1ccccc1)CN(C)C