N,N-Dimethyl-2-chlorophenethylamine
2-Chloro-N,N-dimethyl-2-phenylethan-1-amine
 10761 C10H14ClN 183.678
 InChI=1S/C10H14ClN/c1-12(2)8-10(11)9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3
 BHDHMUNVUMGSIY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 ClC(c1ccccc1)CN(C)C