1-Chloro-N-methyl-1-phenylpropan-2-amine
 10759 C10H14ClN 183.678
 InChI=1S/C10H14ClN/c1-8(12-2)10(11)9-6-4-3-5-7-9/h3-8,10,12H,1-2H3
 HZCQDJZPLJOGQS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(c1ccccc1)Cl)C