1-Bromo-N-methyl-1-phenylpropan-2-amine
 10758 C10H14BrN 228.129
 InChI=1S/C10H14BrN/c1-8(12-2)10(11)9-6-4-3-5-7-9/h3-8,10,12H,1-2H3
 PCTSITTVLWKNKT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(c1ccccc1)Br)C