N1,N2-Dimethyl-1-phenylpropane-1,2-diamine
 10755 C11H18N2 178.274
 InChI=1S/C11H18N2/c1-9(12-2)11(13-3)10-7-5-4-6-8-10/h4-9,11-13H,1-3H3
 WLFWGHGVSWNVJT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(c1ccccc1)C(NC)C