2-(Dimethylamino)-1-phenylpropane-1-thiol
 10754 C11H17NS 195.324
 InChI=1S/C11H17NS/c1-9(12(2)3)11(13)10-7-5-4-6-8-10/h4-9,11,13H,1-3H3
 YSXALYQYWRGRCA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 SC(C(N(C)C)C)c1ccccc1