Thioephedrine
2-(Methylamino)-1-phenylpropane-1-thiol
 10753 C10H15NS 181.298
 InChI=1S/C10H15NS/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3
 QTTCJJGIROEAEK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(c1ccccc1)S)C