2-Mercapto-2-phenethylamine
2-Amino-1-phenylethane-1-thiol
 10752 C8H11NS 153.245
 InChI=1S/C8H11NS/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8,10H,6,9H2
 QNJQQAPUUXDTKM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(c1ccccc1)S