2-Methyl-3-phenoxycyclopropan-1-amine
 10746 C10H13NO 163.216
 InChI=1S/C10H13NO/c1-7-9(11)10(7)12-8-5-3-2-4-6-8/h2-7,9-10H,11H2,1H3
 LQRHNLJDMBPKSF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC1C(C1N)Oc1ccccc1