N-Methyl-5-phenyl-N-(2-phenylethyl)pentan-1-amine
 10709  C20H27N  281.435
 InChI=1S/C20H27N/c1-21(18-16-20-14-7-3-8-15-20)17-10-4-9-13-19-11-5-2-6-12-19/h2-3,5-8,11-12,14-15H,4,9-10,13,16-18H2,1H3
 VQMJJSGEAGSUQO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1ccccc1)CCCCCc1ccccc1