N-Methyl-5-phenyl-N-(1-phenylpropan-2-yl)pentan-1-amine
 10705  C21H29N  295.462
 InChI=1S/C21H29N/c1-19(18-21-15-8-4-9-16-21)22(2)17-11-5-10-14-20-12-6-3-7-13-20/h3-4,6-9,12-13,15-16,19H,5,10-11,14,17-18H2,1-2H3
 NXFNRAVCNJHYJE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C(Cc1ccccc1)C)CCCCCc1ccccc1