N-Butyl-N-(1-phenylpropan-2-yl)butan-1-amine
 10701  C17H29N  247.419
 InChI=1S/C17H29N/c1-4-6-13-18(14-7-5-2)16(3)15-17-11-9-8-10-12-17/h8-12,16H,4-7,13-15H2,1-3H3
 NZYBJDSRVQRZDZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCN(C(Cc1ccccc1)C)CCCC