N-Methyl-N-ethylamphetamine
N-Ethyl-N-methyl-1-phenylpropan-2-amine
 10698 C12H19N 177.286
 InChI=1S/C12H19N/c1-4-13(3)11(2)10-12-8-6-5-7-9-12/h5-9,11H,4,10H2,1-3H3
 RGXSEQYXMRRSTM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(C(Cc1ccccc1)C)C