Sotalol
N-(4-{1-Hydroxy-2-[(propan-2-yl)amino]ethyl}phenyl)methanesulfonamide
 10614  C12H20N2O3S  272.364
 InChI=1S/C12H20N2O3S/c1-9(2)13-8-12(15)10-4-6-11(7-5-10)14-18(3,16)17/h4-7,9,12-15H,8H2,1-3H3
 ZBMZVLHSJCTVON-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(NCC(c1ccc(cc1)NS(=O)(=O)C)O)C