4-[2-(Diethylamino)propoxy]benzonitrile
 10613 C14H20N2O 232.321
 InChI=1S/C14H20N2O/c1-4-16(5-2)12(3)11-17-14-8-6-13(10-15)7-9-14/h6-9,12H,4-5,11H2,1-3H3
 JDZOIMJMMNZGHE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(C(COc1ccc(cc1)C#N)C)CC