4-[2-(Cyclopropylamino)ethoxy]aniline
 10596 C11H16N2O 192.258
 InChI=1S/C11H16N2O/c12-9-1-5-11(6-2-9)14-8-7-13-10-3-4-10/h1-2,5-6,10,13H,3-4,7-8,12H2
 JAMQGRVALBLSGM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Nc1ccc(cc1)OCCNC1CC1