PIB
1-(4-Iodophenyl)butan-2-amine
 10580  C10H14IN  275.129
 InChI=1S/C10H14IN/c1-2-10(12)7-8-3-5-9(11)6-4-8/h3-6,10H,2,7,12H2,1H3
 JWMJUZYYHWCLDC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(Cc1ccc(cc1)I)N