N-[2-(4-Hydroxyphenyl)ethyl]propan-2-amine N-oxide
 10552 C11H17NO2 195.258
 InChI=1S/C11H17NO2/c1-9(2)12(14)8-7-10-3-5-11(13)6-4-10/h3-6,9,12-13H,7-8H2,1-2H3
 IFYYRUPBWFDAEY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC([N](=O)CCc1ccc(cc1)O)C