N-[2-(4-Methoxyphenyl)ethyl]acetamide
 10548 C11H15NO2 193.242
 InChI=1S/C11H15NO2/c1-9(13)12-8-7-10-3-5-11(14-2)6-4-10/h3-6H,7-8H2,1-2H3,(H,12,13)
 VIFWHZYHQSVJGD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(cc1)CCNC(=O)C