3-(1-Aminobut-3-yn-2-yl)phenol
 10525  C10H11NO  161.2
 InChI=1S/C10H11NO/c1-2-8(7-11)9-4-3-5-10(12)6-9/h1,3-6,8,12H,7,11H2
 DDIRPTZZQVMPTP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(c1cccc(c1)O)C#C