2-Amino-1-(3-fluorophenyl)ethan-1-ol
 10521  C8H10FNO  155.17
 InChI=1S/C8H10FNO/c9-7-3-1-2-6(4-7)8(11)5-10/h1-4,8,11H,5,10H2
 KLIPUNKCUPNMHM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(c1cccc(c1)F)O