Etilefrine
3-[2-(Ethylamino)-1-hydroxyethyl]phenol
 10519 C10H15NO2 181.232
 InChI=1S/C10H15NO2/c1-2-11-7-10(13)8-4-3-5-9(12)6-8/h3-6,10-13H,2,7H2,1H3
 SQVIAVUSQAWMKL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNCC(c1cccc(c1)O)O