2-({1-[3-(Trifluoromethyl)phenyl]propan-2-yl}amino)ethan-1-ol
 10517  C12H16F3NO  247.257
 InChI=1S/C12H16F3NO/c1-9(16-5-6-17)7-10-3-2-4-11(8-10)12(13,14)15/h2-4,8-9,16-17H,5-7H2,1H3
 QAFJMZFAQFGVJS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 OCCNC(Cc1cccc(c1)C(F)(F)F)C